C17H27NO2 — CID 134576685
1-(2-methoxyethyl)-4-methyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]oxypiperidine (PubChem CID 134576685) has the molecular formula C17H27NO2 and a molecular weight of 277.41 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-4-methyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]oxypiperidine.
| Compound Name | 1-(2-methoxyethyl)-4-methyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]oxypiperidine |
|---|---|
| PubChem CID | 134576685 |
| Molecular Formula | C17H27NO2 |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | 1-(2-methoxyethyl)-4-methyl-4-[(3E,5Z)-octa-1,3,5,7-tetraen-4-yl]oxypiperidine |
| SMILES | C=C/C=C\C(=C/C=C)OC1(C)CCN(CCOC)CC1 |
| InChI | InChI=1S/C17H27NO2/c1-5-7-9-16(8-6-2)20-17(3)10-12-18(13-11-17)14-15-19-4/h5-9H,1-2,10-15H2,3-4H3/b9-7-,16-8+ |
| InChIKey | JQVLTLNXCIIDDW-KQGIKXCNSA-N |
| XLogP | 3.32 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|