C22H33NO2 — CID 134576681
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperidine (PubChem CID 134576681) has the molecular formula C22H33NO2 and a molecular weight of 343.51 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperidine.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperidine |
|---|---|
| PubChem CID | 134576681 |
| Molecular Formula | C22H33NO2 |
| Molecular Weight | 343.51 g/mol |
| Exact Mass | 343.25 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-1-[2-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxyethyl]-4-methylpiperidine |
| SMILES | C=C/C=C\C(=C/C)OCCN1CCC(C)(OC(/C=C\C)=C/C=C)CC1 |
| InChI | InChI=1S/C22H33NO2/c1-6-10-13-20(9-4)24-19-18-23-16-14-22(5,15-17-23)25-21(11-7-2)12-8-3/h6-13H,1-2,14-19H2,3-5H3/b12-8-,13-10-,20-9+,21-11+ |
| InChIKey | ISOAFMNCCNXHJV-KSXDQVPSSA-N |
| XLogP | 5.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|