C11H19NO2 — CID 91541811
4-(2-penta-2,4-dien-2-yloxyethyl)morpholine (PubChem CID 91541811) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 4-(2-penta-2,4-dien-2-yloxyethyl)morpholine.
| Compound Name | 4-(2-penta-2,4-dien-2-yloxyethyl)morpholine |
|---|---|
| PubChem CID | 91541811 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 4-(2-penta-2,4-dien-2-yloxyethyl)morpholine |
| SMILES | C=CC=C(C)OCCN1CCOCC1 |
| InChI | InChI=1S/C11H19NO2/c1-3-4-11(2)14-10-7-12-5-8-13-9-6-12/h3-4H,1,5-10H2,2H3 |
| InChIKey | IRACNVQOSKRJGK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|