C16H14O8 — CID 91552092
2-(7,8-diacetyloxy-4-methyl-2-oxochromen-3-yl)acetic acid (PubChem CID 91552092) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is 2-(7,8-diacetyloxy-4-methyl-2-oxochromen-3-yl)acetic acid.
| Compound Name | 2-(7,8-diacetyloxy-4-methyl-2-oxochromen-3-yl)acetic acid |
|---|---|
| PubChem CID | 91552092 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(7,8-diacetyloxy-4-methyl-2-oxochromen-3-yl)acetic acid |
| SMILES | CC(=O)Oc1ccc2c(C)c(CC(=O)O)c(=O)oc2c1OC(C)=O |
| InChI | InChI=1S/C16H14O8/c1-7-10-4-5-12(22-8(2)17)15(23-9(3)18)14(10)24-16(21)11(7)6-13(19)20/h4-5H,6H2,1-3H3,(H,19,20) |
| InChIKey | HGQUIRLVMRTYGZ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 120.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|