3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate

C8H16O7P2 — CID 91552244

IUPAC3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate
SMILESCC(=CCOP(=O)(O)OP(=O)(O)O)C1(C)CC1
InChIInChI=1S/C8H16O7P2/c1-7(8(2)4-5-8)3-6-14-17(12,13)15-16(9,10)11/h3H,4-6H2,1-2H3,(H,12,13)(H2,9,10,11)
InChIKeySRGCIYWXNOGGPA-UHFFFAOYSA-N
MW286.16 g/mol
LogP1.96
Rot. Bonds6

About 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate

3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate (PubChem CID 91552244) has the molecular formula C8H16O7P2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate.

Molecular Properties

Compound Name3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate
PubChem CID91552244
Molecular FormulaC8H16O7P2
Molecular Weight286.16 g/mol
Exact Mass286.04
IUPAC Name3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate
SMILESCC(=CCOP(=O)(O)OP(=O)(O)O)C1(C)CC1
InChIInChI=1S/C8H16O7P2/c1-7(8(2)4-5-8)3-6-14-17(12,13)15-16(9,10)11/h3H,4-6H2,1-2H3,(H,12,13)(H2,9,10,11)
InChIKeySRGCIYWXNOGGPA-UHFFFAOYSA-N
XLogP1.96
TPSA113.29 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.16
LogP ≤ 51.96
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate?
The IUPAC name of 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate (CID 91552244) is 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate.
What is the SMILES notation for 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate?
The canonical SMILES for 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate is CC(=CCOP(=O)(O)OP(=O)(O)O)C1(C)CC1.
What is the InChIKey of 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate?
The InChIKey is SRGCIYWXNOGGPA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O7P2/c1-7(8(2)4-5-8)3-6-14-17(12,13)15-16(9,10)11/h3H,4-6H2,1-2H3,(H,12,13)(H2,9,10,11).
What are the key properties of 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate?
3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate has a molecular weight of 286.16 g/mol, XLogP of 1.96, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate is sourced from PubChem (CID 91552244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).