C8H16O7P2 — CID 91552244
3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate (PubChem CID 91552244) has the molecular formula C8H16O7P2 and a molecular weight of 286.16 g/mol. Its IUPAC name is 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate.
| Compound Name | 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 91552244 |
| Molecular Formula | C8H16O7P2 |
| Molecular Weight | 286.16 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 3-(1-methylcyclopropyl)but-2-enyl phosphono hydrogen phosphate |
| SMILES | CC(=CCOP(=O)(O)OP(=O)(O)O)C1(C)CC1 |
| InChI | InChI=1S/C8H16O7P2/c1-7(8(2)4-5-8)3-6-14-17(12,13)15-16(9,10)11/h3H,4-6H2,1-2H3,(H,12,13)(H2,9,10,11) |
| InChIKey | SRGCIYWXNOGGPA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|