C21H40O4Si — CID 91553583
(3R,4S,5S,6S,7S)-7-[dimethyl(propan-2-yl)silyl]oxy-5-methoxy-4-(6-methylhept-2-en-2-yl)-1-oxaspiro[2.5]octan-6-ol (PubChem CID 91553583) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is (3R,4S,5S,6S,7S)-7-[dimethyl(propan-2-yl)silyl]oxy-5-methoxy-4-(6-methylhept-2-en-2-yl)-1-oxaspiro[2.5]octan-6-ol.
| Compound Name | (3R,4S,5S,6S,7S)-7-[dimethyl(propan-2-yl)silyl]oxy-5-methoxy-4-(6-methylhept-2-en-2-yl)-1-oxaspiro[2.5]octan-6-ol |
|---|---|
| PubChem CID | 91553583 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | (3R,4S,5S,6S,7S)-7-[dimethyl(propan-2-yl)silyl]oxy-5-methoxy-4-(6-methylhept-2-en-2-yl)-1-oxaspiro[2.5]octan-6-ol |
| SMILES | CO[C@H]1C(C(C)=CCCC(C)C)[C@@]2(CO2)C[C@H](O[Si](C)(C)C(C)C)[C@H]1O |
| InChI | InChI=1S/C21H40O4Si/c1-14(2)10-9-11-16(5)18-20(23-6)19(22)17(12-21(18)13-24-21)25-26(7,8)15(3)4/h11,14-15,17-20,22H,9-10,12-13H2,1-8H3/t17-,18?,19+,20-,21-/m0/s1 |
| InChIKey | FJZNYHRLLMVKRS-GPQPSWNGSA-N |
| XLogP | 4.53 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|