C25H22N2O3S — CID 91559688
4-[[4-[(4-methanimidoylphenyl)methyl]-8-methyl-3-oxo-1,4-benzothiazin-2-yl]methyl]benzoic acid (PubChem CID 91559688) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is 4-[[4-[(4-methanimidoylphenyl)methyl]-8-methyl-3-oxo-1,4-benzothiazin-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[4-[(4-methanimidoylphenyl)methyl]-8-methyl-3-oxo-1,4-benzothiazin-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 91559688 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-[[4-[(4-methanimidoylphenyl)methyl]-8-methyl-3-oxo-1,4-benzothiazin-2-yl]methyl]benzoic acid |
| SMILES | [H]/N=C/c1ccc(CN2C(=O)C(Cc3ccc(C(=O)O)cc3)Sc3c(C)cccc32)cc1 |
| InChI | InChI=1S/C25H22N2O3S/c1-16-3-2-4-21-23(16)31-22(13-17-9-11-20(12-10-17)25(29)30)24(28)27(21)15-19-7-5-18(14-26)6-8-19/h2-12,14,22,26H,13,15H2,1H3,(H,29,30)/b26-14+ |
| InChIKey | NGVLKWHJGJABNL-VULFUBBASA-N |
| XLogP | 4.94 |
| TPSA | 81.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|