C22H24N3O2- — CID 91559934
N,1-dimethylpiperidine-4-carboxamide;N-methyltrideca-2,4,6,8,10-pentaynamide (PubChem CID 91559934) has the molecular formula C22H24N3O2- and a molecular weight of 362.45 g/mol. Its IUPAC name is N,1-dimethylpiperidine-4-carboxamide;N-methyltrideca-2,4,6,8,10-pentaynamide.
| Compound Name | N,1-dimethylpiperidine-4-carboxamide;N-methyltrideca-2,4,6,8,10-pentaynamide |
|---|---|
| PubChem CID | 91559934 |
| Molecular Formula | C22H24N3O2- |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | N,1-dimethylpiperidine-4-carboxamide;N-methyltrideca-2,4,6,8,10-pentaynamide |
| SMILES | CNC(=O)C1CCN(C)CC1.C[CH-]C#CC#CC#CC#CC#CC(=O)NC |
| InChI | InChI=1S/C14H8NO.C8H16N2O/c1-3-4-5-6-7-8-9-10-11-12-13-14(16)15-2;1-9-8(11)7-3-5-10(2)6-4-7/h3H,1-2H3,(H,15,16);7H,3-6H2,1-2H3,(H,9,11)/q-1; |
| InChIKey | CIMDMVTVQLQWQO-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|