C41H54ClN2O3S+ — CID 91561987
4-[2-[2-[2-chloro-3-[2-(3,3,5-trimethyl-1-pentylindol-2-ylidene)ethylidene]cyclopenten-1-yl]ethenyl]-5-ethyl-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid (PubChem CID 91561987) has the molecular formula C41H54ClN2O3S+ and a molecular weight of 690.41 g/mol. Its IUPAC name is 4-[2-[2-[2-chloro-3-[2-(3,3,5-trimethyl-1-pentylindol-2-ylidene)ethylidene]cyclopenten-1-yl]ethenyl]-5-ethyl-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[2-[2-[2-chloro-3-[2-(3,3,5-trimethyl-1-pentylindol-2-ylidene)ethylidene]cyclopenten-1-yl]ethenyl]-5-ethyl-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 91561987 |
| Molecular Formula | C41H54ClN2O3S+ |
| Molecular Weight | 690.41 g/mol |
| Exact Mass | 689.35 |
| IUPAC Name | 4-[2-[2-[2-chloro-3-[2-(3,3,5-trimethyl-1-pentylindol-2-ylidene)ethylidene]cyclopenten-1-yl]ethenyl]-5-ethyl-3,3-dimethylindol-1-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CCCCCN1C(=CC=C2CCC(C=CC3=[N+](CCCCS(=O)(=O)O)c4ccc(CC)cc4C3(C)C)=C2Cl)C(C)(C)c2cc(C)ccc21 |
| InChI | InChI=1S/C41H53ClN2O3S/c1-8-10-11-24-43-35-20-14-29(3)27-33(35)40(4,5)37(43)22-18-31-16-17-32(39(31)42)19-23-38-41(6,7)34-28-30(9-2)15-21-36(34)44(38)25-12-13-26-48(45,46)47/h14-15,18-23,27-28H,8-13,16-17,24-26H2,1-7H3/p+1 |
| InChIKey | JCICACHEKZJLBZ-UHFFFAOYSA-O |
| XLogP | 10.24 |
| TPSA | 60.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.41 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|