C12H15NOS — CID 91563809
4-(1-methoxyethyl)-2-phenyl-4,5-dihydro-1,3-thiazole (PubChem CID 91563809) has the molecular formula C12H15NOS and a molecular weight of 221.32 g/mol. Its IUPAC name is 4-(1-methoxyethyl)-2-phenyl-4,5-dihydro-1,3-thiazole.
| Compound Name | 4-(1-methoxyethyl)-2-phenyl-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 91563809 |
| Molecular Formula | C12H15NOS |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.09 |
| IUPAC Name | 4-(1-methoxyethyl)-2-phenyl-4,5-dihydro-1,3-thiazole |
| SMILES | COC(C)C1CSC(c2ccccc2)=N1 |
| InChI | InChI=1S/C12H15NOS/c1-9(14-2)11-8-15-12(13-11)10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3 |
| InChIKey | RQAGGOLLMSZXAM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |