C9H4O — CID 91564060
2-(2-bicyclo[4.1.0]hepta-1(7),3,5-trienylidene)ethenone (PubChem CID 91564060) has the molecular formula C9H4O and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-(2-bicyclo[4.1.0]hepta-1(7),3,5-trienylidene)ethenone.
| Compound Name | 2-(2-bicyclo[4.1.0]hepta-1(7),3,5-trienylidene)ethenone |
|---|---|
| PubChem CID | 91564060 |
| Molecular Formula | C9H4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.03 |
| IUPAC Name | 2-(2-bicyclo[4.1.0]hepta-1(7),3,5-trienylidene)ethenone |
| SMILES | O=C=C=c1cccc2c1=C2 |
| InChI | InChI=1S/C9H4O/c10-5-4-7-2-1-3-8-6-9(7)8/h1-3,6H |
| InChIKey | AMVMAMQNQDRPLH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|