C10H17NO — CID 91564422
4,7-dimethyl-3-propan-2-yl-4,5-dihydrooxazepine (PubChem CID 91564422) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 4,7-dimethyl-3-propan-2-yl-4,5-dihydrooxazepine.
| Compound Name | 4,7-dimethyl-3-propan-2-yl-4,5-dihydrooxazepine |
|---|---|
| PubChem CID | 91564422 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 4,7-dimethyl-3-propan-2-yl-4,5-dihydrooxazepine |
| SMILES | CC1=CCC(C)C(C(C)C)=NO1 |
| InChI | InChI=1S/C10H17NO/c1-7(2)10-8(3)5-6-9(4)12-11-10/h6-8H,5H2,1-4H3 |
| InChIKey | YMWMWERFEOZVTL-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |