C12H12F5NO — CID 91566121
N-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]butanamide (PubChem CID 91566121) has the molecular formula C12H12F5NO and a molecular weight of 281.22 g/mol. Its IUPAC name is N-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]butanamide.
| Compound Name | N-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 91566121 |
| Molecular Formula | C12H12F5NO |
| Molecular Weight | 281.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | N-[2-(1,1,2,2,2-pentafluoroethyl)phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccccc1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H12F5NO/c1-2-5-10(19)18-9-7-4-3-6-8(9)11(13,14)12(15,16)17/h3-4,6-7H,2,5H2,1H3,(H,18,19) |
| InChIKey | GBGXULDPDCCGFU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.22 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|