C13H8F14N+ — CID 91567181
dimethyl-(2,3,5-trifluorophenyl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)azanium (PubChem CID 91567181) has the molecular formula C13H8F14N+ and a molecular weight of 444.19 g/mol. Its IUPAC name is dimethyl-(2,3,5-trifluorophenyl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)azanium.
| Compound Name | dimethyl-(2,3,5-trifluorophenyl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)azanium |
|---|---|
| PubChem CID | 91567181 |
| Molecular Formula | C13H8F14N+ |
| Molecular Weight | 444.19 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | dimethyl-(2,3,5-trifluorophenyl)-(1,1,2,2,3,3,4,4,5,5,5-undecafluoropentyl)azanium |
| SMILES | C[N+](C)(c1cc(F)cc(F)c1F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H8F14N/c1-28(2,7-4-5(14)3-6(15)8(7)16)13(26,27)11(21,22)9(17,18)10(19,20)12(23,24)25/h3-4H,1-2H3/q+1 |
| InChIKey | KLVFACRKPRRDDJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.19 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|