About N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride
N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride (PubChem CID 91572866) has the molecular formula C9H20ClNO5S
and a molecular weight of 289.78 g/mol. Its IUPAC name is N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride.
Molecular Properties
| Compound Name | N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride |
| PubChem CID | 91572866 |
| Molecular Formula | C9H20ClNO5S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride |
| SMILES | CC(=O)NCCCCOCCO.CS(=O)(=O)Cl |
| InChI | InChI=1S/C8H17NO3.CH3ClO2S/c1-8(11)9-4-2-3-6-12-7-5-10;1-5(2,3)4/h10H,2-7H2,1H3,(H,9,11);1H3 |
| InChIKey | KGWNSWLSAHBEPC-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride?
The IUPAC name of N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride (CID 91572866) is N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride.
What is the SMILES notation for N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride?
The canonical SMILES for N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride is CC(=O)NCCCCOCCO.CS(=O)(=O)Cl.
What is the InChIKey of N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride?
The InChIKey is KGWNSWLSAHBEPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3.CH3ClO2S/c1-8(11)9-4-2-3-6-12-7-5-10;1-5(2,3)4/h10H,2-7H2,1H3,(H,9,11);1H3.
What are the key properties of N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride?
N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride has a molecular weight of 289.78 g/mol, XLogP of 0.10, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2-hydroxyethoxy)butyl]acetamide;methanesulfonyl chloride is sourced from PubChem (CID 91572866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).