C18H32O3 — CID 91574002
1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol (PubChem CID 91574002) has the molecular formula C18H32O3 and a molecular weight of 296.45 g/mol. Its IUPAC name is 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol.
| Compound Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 91574002 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | 1-[2-(2,3,3a,4,5,6,7,7a-octahydro-1H-inden-5-yl)-6-ethyl-1,3-dioxan-4-yl]propan-2-ol |
| SMILES | CCC1CC(CC(C)O)OC(C2CCC3CCCC3C2)O1 |
| InChI | InChI=1S/C18H32O3/c1-3-16-11-17(9-12(2)19)21-18(20-16)15-8-7-13-5-4-6-14(13)10-15/h12-19H,3-11H2,1-2H3 |
| InChIKey | CEEQGUOUUYCJJS-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |