C20H42O6 — CID 159182177
butan-2-ol;5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol (PubChem CID 159182177) has the molecular formula C20H42O6 and a molecular weight of 378.55 g/mol. Its IUPAC name is butan-2-ol;5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol.
| Compound Name | butan-2-ol;5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 159182177 |
| Molecular Formula | C20H42O6 |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.30 |
| IUPAC Name | butan-2-ol;5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol |
| SMILES | CCC(C)O.CCCC1OC(CC)CC(CC(CC(C)O)OC(C)O)O1 |
| InChI | InChI=1S/C16H32O5.C4H10O/c1-5-7-16-20-13(6-2)9-15(21-16)10-14(8-11(3)17)19-12(4)18;1-3-4(2)5/h11-18H,5-10H2,1-4H3;4-5H,3H2,1-2H3 |
| InChIKey | KNAQMRRYPXLABU-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|