C16H32O5 — CID 159182178
5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol (PubChem CID 159182178) has the molecular formula C16H32O5 and a molecular weight of 304.43 g/mol. Its IUPAC name is 5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol.
| Compound Name | 5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol |
|---|---|
| PubChem CID | 159182178 |
| Molecular Formula | C16H32O5 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 5-(6-ethyl-2-propyl-1,3-dioxan-4-yl)-4-(1-hydroxyethoxy)pentan-2-ol |
| SMILES | CCCC1OC(CC)CC(CC(CC(C)O)OC(C)O)O1 |
| InChI | InChI=1S/C16H32O5/c1-5-7-16-20-13(6-2)9-15(21-16)10-14(8-11(3)17)19-12(4)18/h11-18H,5-10H2,1-4H3 |
| InChIKey | HUGISNFTWVFOKG-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|