C23H24N2O4 — CID 91578930
(8S,11R)-4-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)ethyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol (PubChem CID 91578930) has the molecular formula C23H24N2O4 and a molecular weight of 392.46 g/mol. Its IUPAC name is (8S,11R)-4-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)ethyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol.
| Compound Name | (8S,11R)-4-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)ethyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol |
|---|---|
| PubChem CID | 91578930 |
| Molecular Formula | C23H24N2O4 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | (8S,11R)-4-[2-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)ethyl]-4-azatetracyclo[5.4.2.02,6.08,11]trideca-2,5,9,12-tetraene-3,5-diol |
| SMILES | Oc1c2c(c(O)n1CCNCC1COc3ccccc3O1)C1C=CC2[C@H]2C=C[C@@H]12 |
| InChI | InChI=1S/C23H24N2O4/c26-22-20-16-7-8-17(15-6-5-14(15)16)21(20)23(27)25(22)10-9-24-11-13-12-28-18-3-1-2-4-19(18)29-13/h1-8,13-17,24,26-27H,9-12H2/t13?,14-,15+,16?,17? |
| InChIKey | DEJSGNJTNSTTMA-HXGYVLDSSA-N |
| XLogP | 2.88 |
| TPSA | 75.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|