C16H25NO — CID 91584734
2,5-diethylfuran;2,5-diethyl-1H-pyrrole (PubChem CID 91584734) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is 2,5-diethylfuran;2,5-diethyl-1H-pyrrole.
| Compound Name | 2,5-diethylfuran;2,5-diethyl-1H-pyrrole |
|---|---|
| PubChem CID | 91584734 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 2,5-diethylfuran;2,5-diethyl-1H-pyrrole |
| SMILES | CCc1ccc(CC)[nH]1.CCc1ccc(CC)o1 |
| InChI | InChI=1S/C8H13N.C8H12O/c2*1-3-7-5-6-8(4-2)9-7/h5-6,9H,3-4H2,1-2H3;5-6H,3-4H2,1-2H3 |
| InChIKey | PKERDOGKYLOMTJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 28.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |