About 2-propylidenepentanedial
2-propylidenepentanedial (PubChem CID 91586241) has the molecular formula C8H12O2
and a molecular weight of 140.18 g/mol. Its IUPAC name is 2-propylidenepentanedial.
Molecular Properties
| Compound Name | 2-propylidenepentanedial |
| PubChem CID | 91586241 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 2-propylidenepentanedial |
| SMILES | CCC=C(C=O)CCC=O |
| InChI | InChI=1S/C8H12O2/c1-2-4-8(7-10)5-3-6-9/h4,6-7H,2-3,5H2,1H3 |
| InChIKey | NYAXFBWUIKBXMC-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-propylidenepentanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylidenepentanedial?
The IUPAC name of 2-propylidenepentanedial (CID 91586241) is 2-propylidenepentanedial.
What is the SMILES notation for 2-propylidenepentanedial?
The canonical SMILES for 2-propylidenepentanedial is CCC=C(C=O)CCC=O.
What is the InChIKey of 2-propylidenepentanedial?
The InChIKey is NYAXFBWUIKBXMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O2/c1-2-4-8(7-10)5-3-6-9/h4,6-7H,2-3,5H2,1H3.
What are the key properties of 2-propylidenepentanedial?
2-propylidenepentanedial has a molecular weight of 140.18 g/mol, XLogP of 1.50, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylidenepentanedial is sourced from PubChem (CID 91586241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).