C20H23N — CID 91587647
6,6-dimethyl-2-propan-2-yl-4-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11,13-heptaene (PubChem CID 91587647) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 6,6-dimethyl-2-propan-2-yl-4-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11,13-heptaene.
| Compound Name | 6,6-dimethyl-2-propan-2-yl-4-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11,13-heptaene |
|---|---|
| PubChem CID | 91587647 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 6,6-dimethyl-2-propan-2-yl-4-azatricyclo[9.5.0.03,9]hexadeca-1(16),2,4,7,9,11,13-heptaene |
| SMILES | CC(C)c1c2c(cc3c1=CCC=CC=3)C=CC(C)(C)C=N2 |
| InChI | InChI=1S/C20H23N/c1-14(2)18-17-9-7-5-6-8-15(17)12-16-10-11-20(3,4)13-21-19(16)18/h5-6,8-14H,7H2,1-4H3 |
| InChIKey | QPPIDHKFDLUEKX-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |