C13H14F5NO2 — CID 91592230
2-[3-(1,1,2,2,2-pentafluoroethoxy)phenoxy]piperidine (PubChem CID 91592230) has the molecular formula C13H14F5NO2 and a molecular weight of 311.25 g/mol. Its IUPAC name is 2-[3-(1,1,2,2,2-pentafluoroethoxy)phenoxy]piperidine.
| Compound Name | 2-[3-(1,1,2,2,2-pentafluoroethoxy)phenoxy]piperidine |
|---|---|
| PubChem CID | 91592230 |
| Molecular Formula | C13H14F5NO2 |
| Molecular Weight | 311.25 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[3-(1,1,2,2,2-pentafluoroethoxy)phenoxy]piperidine |
| SMILES | FC(F)(F)C(F)(F)Oc1cccc(OC2CCCCN2)c1 |
| InChI | InChI=1S/C13H14F5NO2/c14-12(15,16)13(17,18)21-10-5-3-4-9(8-10)20-11-6-1-2-7-19-11/h3-5,8,11,19H,1-2,6-7H2 |
| InChIKey | UJDIUAVYSXSADV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|