C8H7BF9OP — CID 175387002
[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]phosphanium tetrafluoroborate (PubChem CID 175387002) has the molecular formula C8H7BF9OP and a molecular weight of 331.91 g/mol. Its IUPAC name is [3-(1,1,2,2,2-pentafluoroethoxy)phenyl]phosphanium tetrafluoroborate.
| Compound Name | [3-(1,1,2,2,2-pentafluoroethoxy)phenyl]phosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 175387002 |
| Molecular Formula | C8H7BF9OP |
| Molecular Weight | 331.91 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | [3-(1,1,2,2,2-pentafluoroethoxy)phenyl]phosphanium tetrafluoroborate |
| SMILES | FC(F)(F)C(F)(F)Oc1cccc([PH3+])c1.F[B-](F)(F)F |
| InChI | InChI=1S/C8H6F5OP.BF4/c9-7(10,11)8(12,13)14-5-2-1-3-6(15)4-5;2-1(3,4)5/h1-4H,15H2;/q;-1/p+1 |
| InChIKey | IAGVAZZYQNXKMP-UHFFFAOYSA-O |
| XLogP | 3.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.91 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|