C16H14F5NO — CID 91270383
N-[2-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]aniline (PubChem CID 91270383) has the molecular formula C16H14F5NO and a molecular weight of 331.28 g/mol. Its IUPAC name is N-[2-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]aniline.
| Compound Name | N-[2-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]aniline |
|---|---|
| PubChem CID | 91270383 |
| Molecular Formula | C16H14F5NO |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | N-[2-[3-(1,1,2,2,2-pentafluoroethoxy)phenyl]ethyl]aniline |
| SMILES | FC(F)(F)C(F)(F)Oc1cccc(CCNc2ccccc2)c1 |
| InChI | InChI=1S/C16H14F5NO/c17-15(18,19)16(20,21)23-14-8-4-5-12(11-14)9-10-22-13-6-2-1-3-7-13/h1-8,11,22H,9-10H2 |
| InChIKey | QKFXJUCZMSNIOM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|