C18H22O3 — CID 91593489
6-(5-hydroxy-4,4-dimethylpentyl)-4-phenylpyran-2-one (PubChem CID 91593489) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 6-(5-hydroxy-4,4-dimethylpentyl)-4-phenylpyran-2-one.
| Compound Name | 6-(5-hydroxy-4,4-dimethylpentyl)-4-phenylpyran-2-one |
|---|---|
| PubChem CID | 91593489 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 6-(5-hydroxy-4,4-dimethylpentyl)-4-phenylpyran-2-one |
| SMILES | CC(C)(CO)CCCc1cc(-c2ccccc2)cc(=O)o1 |
| InChI | InChI=1S/C18H22O3/c1-18(2,13-19)10-6-9-16-11-15(12-17(20)21-16)14-7-4-3-5-8-14/h3-5,7-8,11-12,19H,6,9-10,13H2,1-2H3 |
| InChIKey | ASZQPAJVBBZSRR-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |