C13H11NOS — CID 91594329
3a,9b-dihydrobenzo[g][1]benzothiole-3-carboxamide (PubChem CID 91594329) has the molecular formula C13H11NOS and a molecular weight of 229.30 g/mol. Its IUPAC name is 3a,9b-dihydrobenzo[g][1]benzothiole-3-carboxamide.
| Compound Name | 3a,9b-dihydrobenzo[g][1]benzothiole-3-carboxamide |
|---|---|
| PubChem CID | 91594329 |
| Molecular Formula | C13H11NOS |
| Molecular Weight | 229.30 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | 3a,9b-dihydrobenzo[g][1]benzothiole-3-carboxamide |
| SMILES | NC(=O)C1=CSC2c3ccccc3C=CC12 |
| InChI | InChI=1S/C13H11NOS/c14-13(15)11-7-16-12-9-4-2-1-3-8(9)5-6-10(11)12/h1-7,10,12H,(H2,14,15) |
| InChIKey | WLQMSUDYHNTPTB-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.30 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |