C13H10OS — CID 819886
(3aR,9bR)-3a,9b-dihydrobenzo[g][1]benzothiole-3-carbaldehyde (PubChem CID 819886) has the molecular formula C13H10OS and a molecular weight of 214.29 g/mol. Its IUPAC name is (3aR,9bR)-3a,9b-dihydrobenzo[g][1]benzothiole-3-carbaldehyde.
| Compound Name | (3aR,9bR)-3a,9b-dihydrobenzo[g][1]benzothiole-3-carbaldehyde |
|---|---|
| PubChem CID | 819886 |
| Molecular Formula | C13H10OS |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | (3aR,9bR)-3a,9b-dihydrobenzo[g][1]benzothiole-3-carbaldehyde |
| SMILES | O=CC1=CS[C@H]2c3ccccc3C=C[C@H]12 |
| InChI | InChI=1S/C13H10OS/c14-7-10-8-15-13-11-4-2-1-3-9(11)5-6-12(10)13/h1-8,12-13H/t12-,13+/m1/s1 |
| InChIKey | TWECZXHHGHCOOH-OLZOCXBDSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|