C13H19N2O7P — CID 91595643
[(2S)-1-oxo-1-(2-phosphonoethylamino)propan-2-yl]-phenylmethoxycarbamic acid (PubChem CID 91595643) has the molecular formula C13H19N2O7P and a molecular weight of 346.28 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2-phosphonoethylamino)propan-2-yl]-phenylmethoxycarbamic acid.
| Compound Name | [(2S)-1-oxo-1-(2-phosphonoethylamino)propan-2-yl]-phenylmethoxycarbamic acid |
|---|---|
| PubChem CID | 91595643 |
| Molecular Formula | C13H19N2O7P |
| Molecular Weight | 346.28 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [(2S)-1-oxo-1-(2-phosphonoethylamino)propan-2-yl]-phenylmethoxycarbamic acid |
| SMILES | C[C@@H](C(=O)NCCP(=O)(O)O)N(OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H19N2O7P/c1-10(12(16)14-7-8-23(19,20)21)15(13(17)18)22-9-11-5-3-2-4-6-11/h2-6,10H,7-9H2,1H3,(H,14,16)(H,17,18)(H2,19,20,21)/t10-/m0/s1 |
| InChIKey | SNAJYQDRAISYJK-JTQLQIEISA-N |
| XLogP | 0.78 |
| TPSA | 136.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.28 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|