C14H23N2O5P — CID 101237640
3-[phenylmethoxy(propan-2-ylcarbamoyl)amino]propylphosphonic acid (PubChem CID 101237640) has the molecular formula C14H23N2O5P and a molecular weight of 330.32 g/mol. Its IUPAC name is 3-[phenylmethoxy(propan-2-ylcarbamoyl)amino]propylphosphonic acid.
| Compound Name | 3-[phenylmethoxy(propan-2-ylcarbamoyl)amino]propylphosphonic acid |
|---|---|
| PubChem CID | 101237640 |
| Molecular Formula | C14H23N2O5P |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 3-[phenylmethoxy(propan-2-ylcarbamoyl)amino]propylphosphonic acid |
| SMILES | CC(C)NC(=O)N(CCCP(=O)(O)O)OCc1ccccc1 |
| InChI | InChI=1S/C14H23N2O5P/c1-12(2)15-14(17)16(9-6-10-22(18,19)20)21-11-13-7-4-3-5-8-13/h3-5,7-8,12H,6,9-11H2,1-2H3,(H,15,17)(H2,18,19,20) |
| InChIKey | LRFXVBWVCWTHSJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|