C42H57N3 — CID 91597263
N-[3,5-bis[1-(2,3,4,5-tetramethylphenyl)ethylideneamino]cyclohexyl]-1-(2,3,4,5-tetramethylphenyl)ethanimine (PubChem CID 91597263) has the molecular formula C42H57N3 and a molecular weight of 603.94 g/mol. Its IUPAC name is N-[3,5-bis[1-(2,3,4,5-tetramethylphenyl)ethylideneamino]cyclohexyl]-1-(2,3,4,5-tetramethylphenyl)ethanimine.
| Compound Name | N-[3,5-bis[1-(2,3,4,5-tetramethylphenyl)ethylideneamino]cyclohexyl]-1-(2,3,4,5-tetramethylphenyl)ethanimine |
|---|---|
| PubChem CID | 91597263 |
| Molecular Formula | C42H57N3 |
| Molecular Weight | 603.94 g/mol |
| Exact Mass | 603.46 |
| IUPAC Name | N-[3,5-bis[1-(2,3,4,5-tetramethylphenyl)ethylideneamino]cyclohexyl]-1-(2,3,4,5-tetramethylphenyl)ethanimine |
| SMILES | C/C(=N\C1CC(/N=C(\C)c2cc(C)c(C)c(C)c2C)CC(/N=C(\C)c2cc(C)c(C)c(C)c2C)C1)c1cc(C)c(C)c(C)c1C |
| InChI | InChI=1S/C42H57N3/c1-22-16-40(31(10)28(7)25(22)4)34(13)43-37-19-38(44-35(14)41-17-23(2)26(5)29(8)32(41)11)21-39(20-37)45-36(15)42-18-24(3)27(6)30(9)33(42)12/h16-18,37-39H,19-21H2,1-15H3/b43-34+,44-35+,45-36+ |
| InChIKey | YVRCYHIFGHFJDZ-ZCRZHHRBSA-N |
| XLogP | 10.50 |
| TPSA | 37.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.94 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|