C41H60N2 — CID 91600710
2,7-dimethyl-9,9-dioctylfluorene;1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 91600710) has the molecular formula C41H60N2 and a molecular weight of 580.95 g/mol. Its IUPAC name is 2,7-dimethyl-9,9-dioctylfluorene;1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 2,7-dimethyl-9,9-dioctylfluorene;1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 91600710 |
| Molecular Formula | C41H60N2 |
| Molecular Weight | 580.95 g/mol |
| Exact Mass | 580.48 |
| IUPAC Name | 2,7-dimethyl-9,9-dioctylfluorene;1-N,2-N,3,6-tetramethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | C/N=C1\C(C)=CC=C(C)\C1=N/C.CCCCCCCCC1(CCCCCCCC)c2cc(C)ccc2-c2ccc(C)cc21 |
| InChI | InChI=1S/C31H46.C10H14N2/c1-5-7-9-11-13-15-21-31(22-16-14-12-10-8-6-2)29-23-25(3)17-19-27(29)28-20-18-26(4)24-30(28)31;1-7-5-6-8(2)10(12-4)9(7)11-3/h17-20,23-24H,5-16,21-22H2,1-4H3;5-6H,1-4H3/b;11-9+,12-10+ |
| InChIKey | DRMYLZPIBOCIHU-MXFBUFKSSA-N |
| XLogP | 12.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.95 |
| LogP ≤ 5 | 12.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|