C20H23N5O — CID 91600802
2,3-dimethyl-1,4-dihydroquinoline;1-(9-ethylpurin-6-yl)ethanone (PubChem CID 91600802) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 2,3-dimethyl-1,4-dihydroquinoline;1-(9-ethylpurin-6-yl)ethanone.
| Compound Name | 2,3-dimethyl-1,4-dihydroquinoline;1-(9-ethylpurin-6-yl)ethanone |
|---|---|
| PubChem CID | 91600802 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 2,3-dimethyl-1,4-dihydroquinoline;1-(9-ethylpurin-6-yl)ethanone |
| SMILES | CC1=C(C)Nc2ccccc2C1.CCn1cnc2c(C(C)=O)ncnc21 |
| InChI | InChI=1S/C11H13N.C9H10N4O/c1-8-7-10-5-3-4-6-11(10)12-9(8)2;1-3-13-5-12-8-7(6(2)14)10-4-11-9(8)13/h3-6,12H,7H2,1-2H3;4-5H,3H2,1-2H3 |
| InChIKey | PBOXGPSWRLLFQU-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |