C15H23N — CID 91462835
butane;2,3-dimethyl-1,4-dihydroquinoline (PubChem CID 91462835) has the molecular formula C15H23N and a molecular weight of 217.36 g/mol. Its IUPAC name is butane;2,3-dimethyl-1,4-dihydroquinoline.
| Compound Name | butane;2,3-dimethyl-1,4-dihydroquinoline |
|---|---|
| PubChem CID | 91462835 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | butane;2,3-dimethyl-1,4-dihydroquinoline |
| SMILES | CC1=C(C)Nc2ccccc2C1.CCCC |
| InChI | InChI=1S/C11H13N.C4H10/c1-8-7-10-5-3-4-6-11(10)12-9(8)2;1-3-4-2/h3-6,12H,7H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | IDBUIYZWPCGEEG-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |