C15H12ClF2NO4S — CID 9160242
3-[2-(2-chloro-6-fluorophenyl)ethylsulfamoyl]-4-fluorobenzoic acid (PubChem CID 9160242) has the molecular formula C15H12ClF2NO4S and a molecular weight of 375.78 g/mol. Its IUPAC name is 3-[2-(2-chloro-6-fluorophenyl)ethylsulfamoyl]-4-fluorobenzoic acid.
| Compound Name | 3-[2-(2-chloro-6-fluorophenyl)ethylsulfamoyl]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 9160242 |
| Molecular Formula | C15H12ClF2NO4S |
| Molecular Weight | 375.78 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 3-[2-(2-chloro-6-fluorophenyl)ethylsulfamoyl]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(S(=O)(=O)NCCc2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C15H12ClF2NO4S/c16-11-2-1-3-12(17)10(11)6-7-19-24(22,23)14-8-9(15(20)21)4-5-13(14)18/h1-5,8,19H,6-7H2,(H,20,21) |
| InChIKey | BRYVXXDUUAGOOW-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.78 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |