C12H24O10P2 — CID 91605330
2-diethoxyphosphoryl-2-[methoxy-(2-oxo-2-propan-2-yloxyethyl)phosphoryl]oxyacetic acid (PubChem CID 91605330) has the molecular formula C12H24O10P2 and a molecular weight of 390.26 g/mol. Its IUPAC name is 2-diethoxyphosphoryl-2-[methoxy-(2-oxo-2-propan-2-yloxyethyl)phosphoryl]oxyacetic acid.
| Compound Name | 2-diethoxyphosphoryl-2-[methoxy-(2-oxo-2-propan-2-yloxyethyl)phosphoryl]oxyacetic acid |
|---|---|
| PubChem CID | 91605330 |
| Molecular Formula | C12H24O10P2 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-diethoxyphosphoryl-2-[methoxy-(2-oxo-2-propan-2-yloxyethyl)phosphoryl]oxyacetic acid |
| SMILES | CCOP(=O)(OCC)C(OP(=O)(CC(=O)OC(C)C)OC)C(=O)O |
| InChI | InChI=1S/C12H24O10P2/c1-6-19-24(17,20-7-2)12(11(14)15)22-23(16,18-5)8-10(13)21-9(3)4/h9,12H,6-8H2,1-5H3,(H,14,15) |
| InChIKey | HBXNIWFEOWOGPQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|