C23H29ClN4O — CID 91606363
2-chloro-5-[2-[2-[2-methyl-1-(pentylamino)propan-2-yl]-4-pyridinyl]-1H-imidazol-5-yl]phenol (PubChem CID 91606363) has the molecular formula C23H29ClN4O and a molecular weight of 412.97 g/mol. Its IUPAC name is 2-chloro-5-[2-[2-[2-methyl-1-(pentylamino)propan-2-yl]-4-pyridinyl]-1H-imidazol-5-yl]phenol.
| Compound Name | 2-chloro-5-[2-[2-[2-methyl-1-(pentylamino)propan-2-yl]-4-pyridinyl]-1H-imidazol-5-yl]phenol |
|---|---|
| PubChem CID | 91606363 |
| Molecular Formula | C23H29ClN4O |
| Molecular Weight | 412.97 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-chloro-5-[2-[2-[2-methyl-1-(pentylamino)propan-2-yl]-4-pyridinyl]-1H-imidazol-5-yl]phenol |
| SMILES | CCCCCNCC(C)(C)c1cc(-c2ncc(-c3ccc(Cl)c(O)c3)[nH]2)ccn1 |
| InChI | InChI=1S/C23H29ClN4O/c1-4-5-6-10-25-15-23(2,3)21-13-17(9-11-26-21)22-27-14-19(28-22)16-7-8-18(24)20(29)12-16/h7-9,11-14,25,29H,4-6,10,15H2,1-3H3,(H,27,28) |
| InChIKey | WMNYPFHYFSINRU-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 73.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.97 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|