C25H34N4O3S — CID 91606512
4-amino-N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-4-yl]-N-ethylbenzenesulfonamide (PubChem CID 91606512) has the molecular formula C25H34N4O3S and a molecular weight of 470.64 g/mol. Its IUPAC name is 4-amino-N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-4-yl]-N-ethylbenzenesulfonamide.
| Compound Name | 4-amino-N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-4-yl]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 91606512 |
| Molecular Formula | C25H34N4O3S |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | 4-amino-N-[2-tert-butyl-1-(oxan-4-ylmethyl)benzimidazol-4-yl]-N-ethylbenzenesulfonamide |
| SMILES | CCN(c1cccc2c1nc(C(C)(C)C)n2CC1CCOCC1)S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C25H34N4O3S/c1-5-29(33(30,31)20-11-9-19(26)10-12-20)22-8-6-7-21-23(22)27-24(25(2,3)4)28(21)17-18-13-15-32-16-14-18/h6-12,18H,5,13-17,26H2,1-4H3 |
| InChIKey | KDCXOZMKXDITGS-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 90.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|