C10H12O — CID 91606513
8-methyl-8,8a-dihydro-4H-chromene (PubChem CID 91606513) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 8-methyl-8,8a-dihydro-4H-chromene.
| Compound Name | 8-methyl-8,8a-dihydro-4H-chromene |
|---|---|
| PubChem CID | 91606513 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 8-methyl-8,8a-dihydro-4H-chromene |
| SMILES | CC1C=CC=C2CC=COC21 |
| InChI | InChI=1S/C10H12O/c1-8-4-2-5-9-6-3-7-11-10(8)9/h2-5,7-8,10H,6H2,1H3 |
| InChIKey | CWRKONYATDEYDQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |