C22H25NO5 — CID 91607863
[2-[(2S)-2-amino-3-phenylpropanoyl]oxy-2-phenylacetyl] 3-methylbutanoate (PubChem CID 91607863) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [2-[(2S)-2-amino-3-phenylpropanoyl]oxy-2-phenylacetyl] 3-methylbutanoate.
| Compound Name | [2-[(2S)-2-amino-3-phenylpropanoyl]oxy-2-phenylacetyl] 3-methylbutanoate |
|---|---|
| PubChem CID | 91607863 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [2-[(2S)-2-amino-3-phenylpropanoyl]oxy-2-phenylacetyl] 3-methylbutanoate |
| SMILES | CC(C)CC(=O)OC(=O)C(OC(=O)[C@@H](N)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H25NO5/c1-15(2)13-19(24)27-22(26)20(17-11-7-4-8-12-17)28-21(25)18(23)14-16-9-5-3-6-10-16/h3-12,15,18,20H,13-14,23H2,1-2H3/t18-,20?/m0/s1 |
| InChIKey | PWEKNLMZVIWESD-LROBGIAVSA-N |
| XLogP | 2.96 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|