C30H22N2O2S2+2 — CID 91609953
2'-ethyl-2-methyl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] (PubChem CID 91609953) has the molecular formula C30H22N2O2S2+2 and a molecular weight of 506.65 g/mol. Its IUPAC name is 2'-ethyl-2-methyl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium].
| Compound Name | 2'-ethyl-2-methyl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
|---|---|
| PubChem CID | 91609953 |
| Molecular Formula | C30H22N2O2S2+2 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.11 |
| IUPAC Name | 2'-ethyl-2-methyl-6,6'-spirobi[[1,3]benzothiazolo[3,2-c][1,3]benzoxazin-7-ium] |
| SMILES | CCc1ccc2c(c1)-c1sc3ccccc3[n+]1C1(Oc3ccc(C)cc3-c3sc4ccccc4[n+]31)O2 |
| InChI | InChI=1S/C30H22N2O2S2/c1-3-19-13-15-25-21(17-19)29-32(23-9-5-7-11-27(23)36-29)30(34-25)31-22-8-4-6-10-26(22)35-28(31)20-16-18(2)12-14-24(20)33-30/h4-17H,3H2,1-2H3/q+2 |
| InChIKey | XKXOEVDOWJTGRJ-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 26.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|