About methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate
methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate (PubChem CID 91615302) has the molecular formula C19H24N2O6S2
and a molecular weight of 440.54 g/mol. Its IUPAC name is methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate.
Molecular Properties
| Compound Name | methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate |
| PubChem CID | 91615302 |
| Molecular Formula | C19H24N2O6S2 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate |
| SMILES | COC(=O)N(c1ccc(OC)cc1OC)C1CCN(S(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H24N2O6S2/c1-25-15-6-7-16(17(13-15)26-2)21(19(22)27-3)14-8-10-20(11-9-14)29(23,24)18-5-4-12-28-18/h4-7,12-14H,8-11H2,1-3H3 |
| InChIKey | KHTLBYOWCNUACZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate?
The IUPAC name of methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate (CID 91615302) is methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate.
What is the SMILES notation for methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate?
The canonical SMILES for methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate is COC(=O)N(c1ccc(OC)cc1OC)C1CCN(S(=O)(=O)c2cccs2)CC1.
What is the InChIKey of methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate?
The InChIKey is KHTLBYOWCNUACZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24N2O6S2/c1-25-15-6-7-16(17(13-15)26-2)21(19(22)27-3)14-8-10-20(11-9-14)29(23,24)18-5-4-12-28-18/h4-7,12-14H,8-11H2,1-3H3.
What are the key properties of methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate?
methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate has a molecular weight of 440.54 g/mol, XLogP of 3.19, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl N-(2,4-dimethoxyphenyl)-N-(1-thiophen-2-ylsulfonylpiperidin-4-yl)carbamate is sourced from PubChem (CID 91615302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).