C36H45F6N13O4S2 — CID 91616241
5-N,7-N-bis[2-(2-aminoethylsulfanyl)-3-[3-(diaminomethylideneamino)propanoylamino]-5-(trifluoromethyl)phenyl]-4-ethyl-3H-azepine-5,7-dicarboxamide (PubChem CID 91616241) has the molecular formula C36H45F6N13O4S2 and a molecular weight of 901.96 g/mol. Its IUPAC name is 5-N,7-N-bis[2-(2-aminoethylsulfanyl)-3-[3-(diaminomethylideneamino)propanoylamino]-5-(trifluoromethyl)phenyl]-4-ethyl-3H-azepine-5,7-dicarboxamide.
| Compound Name | 5-N,7-N-bis[2-(2-aminoethylsulfanyl)-3-[3-(diaminomethylideneamino)propanoylamino]-5-(trifluoromethyl)phenyl]-4-ethyl-3H-azepine-5,7-dicarboxamide |
|---|---|
| PubChem CID | 91616241 |
| Molecular Formula | C36H45F6N13O4S2 |
| Molecular Weight | 901.96 g/mol |
| Exact Mass | 901.31 |
| IUPAC Name | 5-N,7-N-bis[2-(2-aminoethylsulfanyl)-3-[3-(diaminomethylideneamino)propanoylamino]-5-(trifluoromethyl)phenyl]-4-ethyl-3H-azepine-5,7-dicarboxamide |
| SMILES | CCC1=C(C(=O)Nc2cc(C(F)(F)F)cc(NC(=O)CCN=C(N)N)c2SCCN)C=C(C(=O)Nc2cc(C(F)(F)F)cc(NC(=O)CCN=C(N)N)c2SCCN)N=CC1 |
| InChI | InChI=1S/C36H45F6N13O4S2/c1-2-18-3-8-49-26(32(59)55-25-16-20(36(40,41)42)14-23(30(25)61-12-7-44)53-28(57)5-10-51-34(47)48)17-21(18)31(58)54-24-15-19(35(37,38)39)13-22(29(24)60-11-6-43)52-27(56)4-9-50-33(45)46/h8,13-17H,2-7,9-12,43-44H2,1H3,(H,52,56)(H,53,57)(H,54,58)(H,55,59)(H4,45,46,50)(H4,47,48,51) |
| InChIKey | NDKPNIIXEYDDMJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 309.60 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 901.96 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|