C23H31ClFN5O3 — CID 91616883
tert-butyl N-[5-[(2-chloropyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]carbamate (PubChem CID 91616883) has the molecular formula C23H31ClFN5O3 and a molecular weight of 479.98 g/mol. Its IUPAC name is tert-butyl N-[5-[(2-chloropyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]carbamate.
| Compound Name | tert-butyl N-[5-[(2-chloropyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]carbamate |
|---|---|
| PubChem CID | 91616883 |
| Molecular Formula | C23H31ClFN5O3 |
| Molecular Weight | 479.98 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | tert-butyl N-[5-[(2-chloropyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]carbamate |
| SMILES | CC(C)(CCCNC(=O)OC(C)(C)C)CN(NC(=O)c1ccc(F)cc1)c1ccnc(Cl)n1 |
| InChI | InChI=1S/C23H31ClFN5O3/c1-22(2,3)33-21(32)27-13-6-12-23(4,5)15-30(18-11-14-26-20(24)28-18)29-19(31)16-7-9-17(25)10-8-16/h7-11,14H,6,12-13,15H2,1-5H3,(H,27,32)(H,29,31) |
| InChIKey | KHTHTADYMWFGJP-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.98 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|