C21H25FN6O2 — CID 70327516
N-[5-[(2-cyanopyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]acetamide (PubChem CID 70327516) has the molecular formula C21H25FN6O2 and a molecular weight of 412.47 g/mol. Its IUPAC name is N-[5-[(2-cyanopyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]acetamide.
| Compound Name | N-[5-[(2-cyanopyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]acetamide |
|---|---|
| PubChem CID | 70327516 |
| Molecular Formula | C21H25FN6O2 |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | N-[5-[(2-cyanopyrimidin-4-yl)-[(4-fluorobenzoyl)amino]amino]-4,4-dimethylpentyl]acetamide |
| SMILES | CC(=O)NCCCC(C)(C)CN(NC(=O)c1ccc(F)cc1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C21H25FN6O2/c1-15(29)24-11-4-10-21(2,3)14-28(19-9-12-25-18(13-23)26-19)27-20(30)16-5-7-17(22)8-6-16/h5-9,12H,4,10-11,14H2,1-3H3,(H,24,29)(H,27,30) |
| InChIKey | TVAIKEBCIOZUHC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|