C18H19F3N6O — CID 11598625
1-[(2-cyanopyrimidin-4-yl)-(2,2-dimethylpropyl)amino]-3-[3-(trifluoromethyl)phenyl]urea (PubChem CID 11598625) has the molecular formula C18H19F3N6O and a molecular weight of 392.39 g/mol. Its IUPAC name is 1-[(2-cyanopyrimidin-4-yl)-(2,2-dimethylpropyl)amino]-3-[3-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[(2-cyanopyrimidin-4-yl)-(2,2-dimethylpropyl)amino]-3-[3-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 11598625 |
| Molecular Formula | C18H19F3N6O |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-[(2-cyanopyrimidin-4-yl)-(2,2-dimethylpropyl)amino]-3-[3-(trifluoromethyl)phenyl]urea |
| SMILES | CC(C)(C)CN(NC(=O)Nc1cccc(C(F)(F)F)c1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C18H19F3N6O/c1-17(2,3)11-27(15-7-8-23-14(10-22)25-15)26-16(28)24-13-6-4-5-12(9-13)18(19,20)21/h4-9H,11H2,1-3H3,(H2,24,26,28) |
| InChIKey | JRCWIQDYAHPXIT-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|