C18H18F3N5O — CID 87891683
N-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-[3-(trifluoromethyl)phenyl]acetohydrazide (PubChem CID 87891683) has the molecular formula C18H18F3N5O and a molecular weight of 377.37 g/mol. Its IUPAC name is N-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-[3-(trifluoromethyl)phenyl]acetohydrazide.
| Compound Name | N-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-[3-(trifluoromethyl)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 87891683 |
| Molecular Formula | C18H18F3N5O |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-(2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)-2-[3-(trifluoromethyl)phenyl]acetohydrazide |
| SMILES | CC(C)CNN(C(=O)Cc1cccc(C(F)(F)F)c1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C18H18F3N5O/c1-12(2)11-24-26(16-6-7-23-15(10-22)25-16)17(27)9-13-4-3-5-14(8-13)18(19,20)21/h3-8,12,24H,9,11H2,1-2H3 |
| InChIKey | IUKHOQQOMXDYNX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|