C18H23FN6O — CID 143197055
1-benzyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]urea;fluoromethane (PubChem CID 143197055) has the molecular formula C18H23FN6O and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-benzyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]urea;fluoromethane.
| Compound Name | 1-benzyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]urea;fluoromethane |
|---|---|
| PubChem CID | 143197055 |
| Molecular Formula | C18H23FN6O |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.19 |
| IUPAC Name | 1-benzyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]urea;fluoromethane |
| SMILES | CC(C)CN(NC(=O)NCc1ccccc1)c1ccnc(C#N)n1.CF |
| InChI | InChI=1S/C17H20N6O.CH3F/c1-13(2)12-23(16-8-9-19-15(10-18)21-16)22-17(24)20-11-14-6-4-3-5-7-14;1-2/h3-9,13H,11-12H2,1-2H3,(H2,20,22,24);1H3 |
| InChIKey | OUUAGSMLBLDBOG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|