C27H40N8O — CID 70327251
1-butyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]urea (PubChem CID 70327251) has the molecular formula C27H40N8O and a molecular weight of 492.67 g/mol. Its IUPAC name is 1-butyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]urea.
| Compound Name | 1-butyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]urea |
|---|---|
| PubChem CID | 70327251 |
| Molecular Formula | C27H40N8O |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.33 |
| IUPAC Name | 1-butyl-3-[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]-1-[[4-[(4-methylpiperazin-1-yl)methyl]phenyl]methyl]urea |
| SMILES | CCCCN(Cc1ccc(CN2CCN(C)CC2)cc1)C(=O)NN(CC(C)C)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C27H40N8O/c1-5-6-13-34(21-24-9-7-23(8-10-24)20-33-16-14-32(4)15-17-33)27(36)31-35(19-22(2)3)26-11-12-29-25(18-28)30-26/h7-12,22H,5-6,13-17,19-21H2,1-4H3,(H,31,36) |
| InChIKey | WIBPDZMVNXQYKV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 91.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|