C22H37N7O2 — CID 70327257
N-[6-[butyl-[[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamoyl]amino]hexyl]acetamide (PubChem CID 70327257) has the molecular formula C22H37N7O2 and a molecular weight of 431.59 g/mol. Its IUPAC name is N-[6-[butyl-[[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamoyl]amino]hexyl]acetamide.
| Compound Name | N-[6-[butyl-[[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamoyl]amino]hexyl]acetamide |
|---|---|
| PubChem CID | 70327257 |
| Molecular Formula | C22H37N7O2 |
| Molecular Weight | 431.59 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | N-[6-[butyl-[[(2-cyanopyrimidin-4-yl)-(2-methylpropyl)amino]carbamoyl]amino]hexyl]acetamide |
| SMILES | CCCCN(CCCCCCNC(C)=O)C(=O)NN(CC(C)C)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C22H37N7O2/c1-5-6-14-28(15-10-8-7-9-12-24-19(4)30)22(31)27-29(17-18(2)3)21-11-13-25-20(16-23)26-21/h11,13,18H,5-10,12,14-15,17H2,1-4H3,(H,24,30)(H,27,31) |
| InChIKey | AOGZXWNBUQQTTJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.59 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|